C15H27NO3 — CID 61143658
(2S)-2-(3-cyclohexylpropanoylamino)-3,3-dimethylbutanoic acid (PubChem CID 61143658) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (2S)-2-(3-cyclohexylpropanoylamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-(3-cyclohexylpropanoylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61143658 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (2S)-2-(3-cyclohexylpropanoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)CCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C15H27NO3/c1-15(2,3)13(14(18)19)16-12(17)10-9-11-7-5-4-6-8-11/h11,13H,4-10H2,1-3H3,(H,16,17)(H,18,19)/t13-/m1/s1 |
| InChIKey | IKAYPUISYZUTIS-CYBMUJFWSA-N |
| XLogP | 2.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |