C14H15NO4 — CID 61143791
(2S)-1-(oxolane-2-carbonyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 61143791) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (2S)-1-(oxolane-2-carbonyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-(oxolane-2-carbonyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 61143791 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2S)-1-(oxolane-2-carbonyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2ccccc2N1C(=O)C1CCCO1 |
| InChI | InChI=1S/C14H15NO4/c16-13(12-6-3-7-19-12)15-10-5-2-1-4-9(10)8-11(15)14(17)18/h1-2,4-5,11-12H,3,6-8H2,(H,17,18)/t11-,12?/m0/s1 |
| InChIKey | PETUQYOKEKXITA-PXYINDEMSA-N |
| XLogP | 1.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |