C15H19NO3S — CID 61144010
(4R)-3-(4-butylbenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61144010) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (4R)-3-(4-butylbenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(4-butylbenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 61144010 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (4R)-3-(4-butylbenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCc1ccc(C(=O)N2CSC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO3S/c1-2-3-4-11-5-7-12(8-6-11)14(17)16-10-20-9-13(16)15(18)19/h5-8,13H,2-4,9-10H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | CUCUZOFXQYUFKJ-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |