About (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid
(2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid (PubChem CID 61144264) has the molecular formula C11H20N2O4
and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid |
| PubChem CID | 61144264 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(=O)NCCC(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H20N2O4/c1-7(14)12-6-5-8(15)13-9(10(16)17)11(2,3)4/h9H,5-6H2,1-4H3,(H,12,14)(H,13,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | DRCZXGRRJRPPNG-SECBINFHSA-N |
| XLogP | 0.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid?
The IUPAC name of (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid (CID 61144264) is (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid.
What is the SMILES notation for (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid?
The canonical SMILES for (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid is CC(=O)NCCC(=O)N[C@H](C(=O)O)C(C)(C)C.
What is the InChIKey of (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid?
The InChIKey is DRCZXGRRJRPPNG-SECBINFHSA-N. The full InChI is InChI=1S/C11H20N2O4/c1-7(14)12-6-5-8(15)13-9(10(16)17)11(2,3)4/h9H,5-6H2,1-4H3,(H,12,14)(H,13,15)(H,16,17)/t9-/m1/s1.
What are the key properties of (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid?
(2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid has a molecular weight of 244.29 g/mol, XLogP of 0.13, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-acetamidopropanoylamino)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 61144264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).