C9H12N2O5S — CID 61144532
(2S)-4-hydroxy-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-2-carboxylic acid (PubChem CID 61144532) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61144532 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (2S)-4-hydroxy-1-(1H-pyrrol-3-ylsulfonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)CN1S(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C9H12N2O5S/c12-6-3-8(9(13)14)11(5-6)17(15,16)7-1-2-10-4-7/h1-2,4,6,8,10,12H,3,5H2,(H,13,14)/t6?,8-/m0/s1 |
| InChIKey | ROJDEYNWXXXVNX-XDKWHASVSA-N |
| XLogP | -0.78 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |