About (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid
(2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid (PubChem CID 61144913) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid.
Molecular Properties
| Compound Name | (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid |
| PubChem CID | 61144913 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)CCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C11H18N4O3/c1-11(2,3)9(10(17)18)13-8(16)4-6-15-7-5-12-14-15/h5,7,9H,4,6H2,1-3H3,(H,13,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | QQBLGCOMGYTIFR-SECBINFHSA-N |
| XLogP | 0.28 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
The IUPAC name of (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid (CID 61144913) is (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid.
What is the SMILES notation for (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
The canonical SMILES for (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid is CC(C)(C)[C@H](NC(=O)CCn1ccnn1)C(=O)O.
What is the InChIKey of (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
The InChIKey is QQBLGCOMGYTIFR-SECBINFHSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-11(2,3)9(10(17)18)13-8(16)4-6-15-7-5-12-14-15/h5,7,9H,4,6H2,1-3H3,(H,13,16)(H,17,18)/t9-/m1/s1.
What are the key properties of (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
(2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid has a molecular weight of 254.29 g/mol, XLogP of 0.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid is sourced from PubChem (CID 61144913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).