C18H13NO3 — CID 6114507
[(E)-(6-oxo-3-tricyclo[6.2.1.02,7]undeca-2(7),4,9-trienylidene)amino] benzoate (PubChem CID 6114507) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is [(E)-(6-oxo-3-tricyclo[6.2.1.02,7]undeca-2(7),4,9-trienylidene)amino] benzoate.
| Compound Name | [(E)-(6-oxo-3-tricyclo[6.2.1.02,7]undeca-2(7),4,9-trienylidene)amino] benzoate |
|---|---|
| PubChem CID | 6114507 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [(E)-(6-oxo-3-tricyclo[6.2.1.02,7]undeca-2(7),4,9-trienylidene)amino] benzoate |
| SMILES | O=C1C=C/C(=N\OC(=O)c2ccccc2)C2=C1C1C=CC2C1 |
| InChI | InChI=1S/C18H13NO3/c20-15-9-8-14(16-12-6-7-13(10-12)17(15)16)19-22-18(21)11-4-2-1-3-5-11/h1-9,12-13H,10H2/b19-14+ |
| InChIKey | JXLBTDVXGRZFCH-XMHGGMMESA-N |
| XLogP | 2.84 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|