About 4-bromo-2,6-diethylaniline
4-bromo-2,6-diethylaniline (PubChem CID 611452) has the molecular formula C10H14BrN
and a molecular weight of 228.13 g/mol. Its IUPAC name is 4-bromo-2,6-diethylaniline.
Molecular Properties
| Compound Name | 4-bromo-2,6-diethylaniline |
| PubChem CID | 611452 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-bromo-2,6-diethylaniline |
| SMILES | CCc1cc(Br)cc(CC)c1N |
| InChI | InChI=1S/C10H14BrN/c1-3-7-5-9(11)6-8(4-2)10(7)12/h5-6H,3-4,12H2,1-2H3 |
| InChIKey | BEJYDMQQZUACPW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,6-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-diethylaniline?
The IUPAC name of 4-bromo-2,6-diethylaniline (CID 611452) is 4-bromo-2,6-diethylaniline.
What is the SMILES notation for 4-bromo-2,6-diethylaniline?
The canonical SMILES for 4-bromo-2,6-diethylaniline is CCc1cc(Br)cc(CC)c1N.
What is the InChIKey of 4-bromo-2,6-diethylaniline?
The InChIKey is BEJYDMQQZUACPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN/c1-3-7-5-9(11)6-8(4-2)10(7)12/h5-6H,3-4,12H2,1-2H3.
What are the key properties of 4-bromo-2,6-diethylaniline?
4-bromo-2,6-diethylaniline has a molecular weight of 228.13 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-diethylaniline is sourced from PubChem (CID 611452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).