C10H18N4 — CID 61145457
2-N-methyl-2-N-pentan-2-ylpyrimidine-2,5-diamine (PubChem CID 61145457) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-N-methyl-2-N-pentan-2-ylpyrimidine-2,5-diamine.
| Compound Name | 2-N-methyl-2-N-pentan-2-ylpyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 61145457 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-N-methyl-2-N-pentan-2-ylpyrimidine-2,5-diamine |
| SMILES | CCCC(C)N(C)c1ncc(N)cn1 |
| InChI | InChI=1S/C10H18N4/c1-4-5-8(2)14(3)10-12-6-9(11)7-13-10/h6-8H,4-5,11H2,1-3H3 |
| InChIKey | KZRXWIILGQLMCO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |