C10H12Cl2N2O — CID 61146210
2-[cyclopropyl-(3,5-dichloro-2-pyridinyl)amino]ethanol (PubChem CID 61146210) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 2-[cyclopropyl-(3,5-dichloro-2-pyridinyl)amino]ethanol.
| Compound Name | 2-[cyclopropyl-(3,5-dichloro-2-pyridinyl)amino]ethanol |
|---|---|
| PubChem CID | 61146210 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-[cyclopropyl-(3,5-dichloro-2-pyridinyl)amino]ethanol |
| SMILES | OCCN(c1ncc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C10H12Cl2N2O/c11-7-5-9(12)10(13-6-7)14(3-4-15)8-1-2-8/h5-6,8,15H,1-4H2 |
| InChIKey | KCFJKAGGPBSFAD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |