About 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol
3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol (PubChem CID 61146701) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol |
| PubChem CID | 61146701 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol |
| SMILES | CC(C)N(CCCO)c1nccs1 |
| InChI | InChI=1S/C9H16N2OS/c1-8(2)11(5-3-6-12)9-10-4-7-13-9/h4,7-8,12H,3,5-6H2,1-2H3 |
| InChIKey | JORBGEZXRFSRBS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol?
The IUPAC name of 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol (CID 61146701) is 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol?
The canonical SMILES for 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol is CC(C)N(CCCO)c1nccs1.
What is the InChIKey of 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol?
The InChIKey is JORBGEZXRFSRBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-8(2)11(5-3-6-12)9-10-4-7-13-9/h4,7-8,12H,3,5-6H2,1-2H3.
What are the key properties of 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol?
3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol has a molecular weight of 200.31 g/mol, XLogP of 1.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[propan-2-yl(1,3-thiazol-2-yl)amino]propan-1-ol is sourced from PubChem (CID 61146701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).