About 2-N-methylpyrimidine-2,5-diamine
2-N-methylpyrimidine-2,5-diamine (PubChem CID 61146915) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 2-N-methylpyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-methylpyrimidine-2,5-diamine |
| PubChem CID | 61146915 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 2-N-methylpyrimidine-2,5-diamine |
| SMILES | CNc1ncc(N)cn1 |
| InChI | InChI=1S/C5H8N4/c1-7-5-8-2-4(6)3-9-5/h2-3H,6H2,1H3,(H,7,8,9) |
| InChIKey | MELWSUDCINDWJI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-methylpyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methylpyrimidine-2,5-diamine?
The IUPAC name of 2-N-methylpyrimidine-2,5-diamine (CID 61146915) is 2-N-methylpyrimidine-2,5-diamine.
What is the SMILES notation for 2-N-methylpyrimidine-2,5-diamine?
The canonical SMILES for 2-N-methylpyrimidine-2,5-diamine is CNc1ncc(N)cn1.
What is the InChIKey of 2-N-methylpyrimidine-2,5-diamine?
The InChIKey is MELWSUDCINDWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-7-5-8-2-4(6)3-9-5/h2-3H,6H2,1H3,(H,7,8,9).
What are the key properties of 2-N-methylpyrimidine-2,5-diamine?
2-N-methylpyrimidine-2,5-diamine has a molecular weight of 124.15 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methylpyrimidine-2,5-diamine is sourced from PubChem (CID 61146915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).