C10H14N4O3 — CID 61147056
5-nitro-N-[1-(oxolan-2-yl)ethyl]pyrimidin-2-amine (PubChem CID 61147056) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 5-nitro-N-[1-(oxolan-2-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-nitro-N-[1-(oxolan-2-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 61147056 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-nitro-N-[1-(oxolan-2-yl)ethyl]pyrimidin-2-amine |
| SMILES | CC(Nc1ncc([N+](=O)[O-])cn1)C1CCCO1 |
| InChI | InChI=1S/C10H14N4O3/c1-7(9-3-2-4-17-9)13-10-11-5-8(6-12-10)14(15)16/h5-7,9H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | OHAPXTXUFZTONW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|