About 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol
3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol (PubChem CID 61147331) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol |
| PubChem CID | 61147331 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H18N2O3S/c1-10(2)15(8-5-9-16)13-11-6-3-4-7-12(11)19(17,18)14-13/h3-4,6-7,10,16H,5,8-9H2,1-2H3 |
| InChIKey | KTUFXCHFAPKTLZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol?
The IUPAC name of 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol (CID 61147331) is 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol.
What is the SMILES notation for 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol?
The canonical SMILES for 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol is CC(C)N(CCCO)C1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol?
The InChIKey is KTUFXCHFAPKTLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-10(2)15(8-5-9-16)13-11-6-3-4-7-12(11)19(17,18)14-13/h3-4,6-7,10,16H,5,8-9H2,1-2H3.
What are the key properties of 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol?
3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol has a molecular weight of 282.36 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-propan-2-ylamino]propan-1-ol is sourced from PubChem (CID 61147331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).