C13H21N3O3S — CID 61148344
(2S)-2-amino-3,3-dimethyl-N-[(4-sulfamoylphenyl)methyl]butanamide (PubChem CID 61148344) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[(4-sulfamoylphenyl)methyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[(4-sulfamoylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 61148344 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[(4-sulfamoylphenyl)methyl]butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21N3O3S/c1-13(2,3)11(14)12(17)16-8-9-4-6-10(7-5-9)20(15,18)19/h4-7,11H,8,14H2,1-3H3,(H,16,17)(H2,15,18,19)/t11-/m1/s1 |
| InChIKey | NUYHHVZMMQXFRC-LLVKDONJSA-N |
| XLogP | 0.32 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |