C13H22N2 — CID 61150632
N-benzyl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 61150632) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-benzyl-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-benzyl-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 61150632 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-benzyl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)NCCCNCc1ccccc1 |
| InChI | InChI=1S/C13H22N2/c1-12(2)15-10-6-9-14-11-13-7-4-3-5-8-13/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3 |
| InChIKey | KPUGWSDMFFQOCH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|