C13H20N2O6 — CID 61151877
(2S)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]pentanedioic acid (PubChem CID 61151877) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2S)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 61151877 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2S)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)CN1CCCCCC1=O)C(=O)O |
| InChI | InChI=1S/C13H20N2O6/c16-10(8-15-7-3-1-2-4-11(15)17)14-9(13(20)21)5-6-12(18)19/h9H,1-8H2,(H,14,16)(H,18,19)(H,20,21)/t9-/m0/s1 |
| InChIKey | POLAYGYNIHRVJF-VIFPVBQESA-N |
| XLogP | -0.18 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |