About (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid
(2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 61152839) has the molecular formula C12H17N3O5S
and a molecular weight of 315.35 g/mol. Its IUPAC name is (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
| PubChem CID | 61152839 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)Cn1ccc(=O)n(C)c1=O)C(=O)O |
| InChI | InChI=1S/C12H17N3O5S/c1-14-10(17)3-5-15(12(14)20)7-9(16)13-8(11(18)19)4-6-21-2/h3,5,8H,4,6-7H2,1-2H3,(H,13,16)(H,18,19)/t8-/m0/s1 |
| InChIKey | BXCDJSULRJOPAN-QMMMGPOBSA-N |
| XLogP | -1.13 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid?
The IUPAC name of (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid (CID 61152839) is (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid.
What is the SMILES notation for (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid?
The canonical SMILES for (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid is CSCC[C@H](NC(=O)Cn1ccc(=O)n(C)c1=O)C(=O)O.
What is the InChIKey of (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid?
The InChIKey is BXCDJSULRJOPAN-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H17N3O5S/c1-14-10(17)3-5-15(12(14)20)7-9(16)13-8(11(18)19)4-6-21-2/h3,5,8H,4,6-7H2,1-2H3,(H,13,16)(H,18,19)/t8-/m0/s1.
What are the key properties of (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid?
(2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid has a molecular weight of 315.35 g/mol, XLogP of -1.13, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 61152839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).