C14H17NO6 — CID 61153100
(2S)-4-hydroxy-1-[2-(2-methoxyphenoxy)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 61153100) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-[2-(2-methoxyphenoxy)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-[2-(2-methoxyphenoxy)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61153100 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-4-hydroxy-1-[2-(2-methoxyphenoxy)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccccc1OCC(=O)N1CC(O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C14H17NO6/c1-20-11-4-2-3-5-12(11)21-8-13(17)15-7-9(16)6-10(15)14(18)19/h2-5,9-10,16H,6-8H2,1H3,(H,18,19)/t9?,10-/m0/s1 |
| InChIKey | HLPHRLGMQJJDSD-AXDSSHIGSA-N |
| XLogP | 0.12 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |