C13H13N3O4 — CID 61153195
(2S)-3-hydroxy-2-[(3-phenylimidazole-4-carbonyl)amino]propanoic acid (PubChem CID 61153195) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(3-phenylimidazole-4-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[(3-phenylimidazole-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61153195 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2S)-3-hydroxy-2-[(3-phenylimidazole-4-carbonyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](CO)C(=O)O)c1cncn1-c1ccccc1 |
| InChI | InChI=1S/C13H13N3O4/c17-7-10(13(19)20)15-12(18)11-6-14-8-16(11)9-4-2-1-3-5-9/h1-6,8,10,17H,7H2,(H,15,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | MGMYZHHHZLBOBK-JTQLQIEISA-N |
| XLogP | 0.05 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |