C11H21N3O4S — CID 61153726
(2S)-2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 61153726) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is (2S)-2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 61153726 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2S)-2-[[2-(carbamoylamino)-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)C(NC(N)=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C11H21N3O4S/c1-6(2)8(14-11(12)18)9(15)13-7(10(16)17)4-5-19-3/h6-8H,4-5H2,1-3H3,(H,13,15)(H,16,17)(H3,12,14,18)/t7-,8?/m0/s1 |
| InChIKey | VYUHAFQJMMZTDH-JAMMHHFISA-N |
| XLogP | 0.00 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |