C14H16N2O3 — CID 61157412
1-[(2S)-pyrrolidine-2-carbonyl]-2,3-dihydroindole-5-carboxylic acid (PubChem CID 61157412) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[(2S)-pyrrolidine-2-carbonyl]-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 1-[(2S)-pyrrolidine-2-carbonyl]-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 61157412 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-[(2S)-pyrrolidine-2-carbonyl]-2,3-dihydroindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCN2C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C14H16N2O3/c17-13(11-2-1-6-15-11)16-7-5-9-8-10(14(18)19)3-4-12(9)16/h3-4,8,11,15H,1-2,5-7H2,(H,18,19)/t11-/m0/s1 |
| InChIKey | WRDOXULVZDXMIO-NSHDSACASA-N |
| XLogP | 1.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |