About [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea
[(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea (PubChem CID 6115834) has the molecular formula C6H8F3N3OS
and a molecular weight of 227.21 g/mol. Its IUPAC name is [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea |
| PubChem CID | 6115834 |
| Molecular Formula | C6H8F3N3OS |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea |
| SMILES | CC(=O)C/C(=N/NC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3OS/c1-3(13)2-4(6(7,8)9)11-12-5(10)14/h2H2,1H3,(H3,10,12,14)/b11-4- |
| InChIKey | UNPFSTBJBJUBIF-WCIBSUBMSA-N |
| XLogP | 0.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea?
The IUPAC name of [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea (CID 6115834) is [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea.
What is the SMILES notation for [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea?
The canonical SMILES for [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea is CC(=O)C/C(=N/NC(N)=S)C(F)(F)F.
What is the InChIKey of [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea?
The InChIKey is UNPFSTBJBJUBIF-WCIBSUBMSA-N. The full InChI is InChI=1S/C6H8F3N3OS/c1-3(13)2-4(6(7,8)9)11-12-5(10)14/h2H2,1H3,(H3,10,12,14)/b11-4-.
What are the key properties of [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea?
[(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea has a molecular weight of 227.21 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]thiourea is sourced from PubChem (CID 6115834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).