C11H22N2O3S — CID 61158846
2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylpentanoic acid (PubChem CID 61158846) has the molecular formula C11H22N2O3S and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61158846 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)[C@@H](N)CCSC)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-4-7(2)9(11(15)16)13-10(14)8(12)5-6-17-3/h7-9H,4-6,12H2,1-3H3,(H,13,14)(H,15,16)/t7?,8-,9?/m0/s1 |
| InChIKey | OGGRSJFVXREKOR-MGURRDGZSA-N |
| XLogP | 0.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |