C9H6BrNO2 — CID 611621
7-bromo-5-methyl-1H-indole-2,3-dione (PubChem CID 611621) has the molecular formula C9H6BrNO2 and a molecular weight of 240.06 g/mol. Its IUPAC name is 7-bromo-5-methyl-1H-indole-2,3-dione.
| Compound Name | 7-bromo-5-methyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 611621 |
| Molecular Formula | C9H6BrNO2 |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | 7-bromo-5-methyl-1H-indole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C9H6BrNO2/c1-4-2-5-7(6(10)3-4)11-9(13)8(5)12/h2-3H,1H3,(H,11,12,13) |
| InChIKey | NPDJRIGMWAQKTQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|