C13H25F3N2O2 — CID 61162805
(2S,3S)-2-amino-N-(3-ethoxypropyl)-3-methyl-N-(2,2,2-trifluoroethyl)pentanamide (PubChem CID 61162805) has the molecular formula C13H25F3N2O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-(3-ethoxypropyl)-3-methyl-N-(2,2,2-trifluoroethyl)pentanamide.
| Compound Name | (2S,3S)-2-amino-N-(3-ethoxypropyl)-3-methyl-N-(2,2,2-trifluoroethyl)pentanamide |
|---|---|
| PubChem CID | 61162805 |
| Molecular Formula | C13H25F3N2O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S,3S)-2-amino-N-(3-ethoxypropyl)-3-methyl-N-(2,2,2-trifluoroethyl)pentanamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)[C@@H](N)[C@@H](C)CC |
| InChI | InChI=1S/C13H25F3N2O2/c1-4-10(3)11(17)12(19)18(9-13(14,15)16)7-6-8-20-5-2/h10-11H,4-9,17H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | SAWULSWGYZDGEI-QWRGUYRKSA-N |
| XLogP | 2.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|