C13H25F3N2O2 — CID 61162806
(2S)-2-amino-N-(3-ethoxypropyl)-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 61162806) has the molecular formula C13H25F3N2O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-ethoxypropyl)-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-2-amino-N-(3-ethoxypropyl)-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 61162806 |
| Molecular Formula | C13H25F3N2O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S)-2-amino-N-(3-ethoxypropyl)-3,3-dimethyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C13H25F3N2O2/c1-5-20-8-6-7-18(9-13(14,15)16)11(19)10(17)12(2,3)4/h10H,5-9,17H2,1-4H3/t10-/m1/s1 |
| InChIKey | VYTZIXMHNYFICA-SNVBAGLBSA-N |
| XLogP | 2.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|