C14H23N3O — CID 61163051
(2S)-2-amino-N-ethyl-4-methyl-N-(pyridin-4-ylmethyl)pentanamide (PubChem CID 61163051) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (2S)-2-amino-N-ethyl-4-methyl-N-(pyridin-4-ylmethyl)pentanamide.
| Compound Name | (2S)-2-amino-N-ethyl-4-methyl-N-(pyridin-4-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 61163051 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (2S)-2-amino-N-ethyl-4-methyl-N-(pyridin-4-ylmethyl)pentanamide |
| SMILES | CCN(Cc1ccncc1)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C14H23N3O/c1-4-17(10-12-5-7-16-8-6-12)14(18)13(15)9-11(2)3/h5-8,11,13H,4,9-10,15H2,1-3H3/t13-/m0/s1 |
| InChIKey | LAPFYJJPKOLEQU-ZDUSSCGKSA-N |
| XLogP | 1.80 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |