C15H20N2O3 — CID 61163138
methyl 1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylate (PubChem CID 61163138) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl 1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 61163138 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl 1-[(2S)-2-amino-3-phenylpropanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-20-15(19)13-8-5-9-17(13)14(18)12(16)10-11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-10,16H2,1H3/t12-,13?/m0/s1 |
| InChIKey | APKLHPGBTJFCPW-UEWDXFNNSA-N |
| XLogP | 0.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |