C13H21N5OS — CID 61164176
(2S)-2-amino-4-methylsulfanyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butan-1-one (PubChem CID 61164176) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butan-1-one.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 61164176 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C13H21N5OS/c1-20-9-2-11(14)13(19)18-7-5-17(6-8-18)12-10-15-3-4-16-12/h3-4,10-11H,2,5-9,14H2,1H3/t11-/m0/s1 |
| InChIKey | KIXZODLETPTQNT-NSHDSACASA-N |
| XLogP | 0.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |