About (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one
(2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one (PubChem CID 61164937) has the molecular formula C13H27N3O3S
and a molecular weight of 305.44 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one.
Molecular Properties
| Compound Name | (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one |
| PubChem CID | 61164937 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one |
| SMILES | CCCS(=O)(=O)N1CCN(C(=O)[C@@H](N)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O3S/c1-5-10-20(18,19)16-8-6-15(7-9-16)12(17)11(14)13(2,3)4/h11H,5-10,14H2,1-4H3/t11-/m1/s1 |
| InChIKey | VNDZHAYADGJKLX-LLVKDONJSA-N |
| XLogP | 0.24 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one?
The IUPAC name of (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one (CID 61164937) is (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one.
What is the SMILES notation for (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one?
The canonical SMILES for (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one is CCCS(=O)(=O)N1CCN(C(=O)[C@@H](N)C(C)(C)C)CC1.
What is the InChIKey of (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one?
The InChIKey is VNDZHAYADGJKLX-LLVKDONJSA-N. The full InChI is InChI=1S/C13H27N3O3S/c1-5-10-20(18,19)16-8-6-15(7-9-16)12(17)11(14)13(2,3)4/h11H,5-10,14H2,1-4H3/t11-/m1/s1.
What are the key properties of (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one?
(2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one has a molecular weight of 305.44 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3,3-dimethyl-1-(4-propylsulfonylpiperazin-1-yl)butan-1-one is sourced from PubChem (CID 61164937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).