C17H26N2O — CID 61165448
(2S)-2-amino-N-cyclopropyl-4-methyl-N-[(4-methylphenyl)methyl]pentanamide (PubChem CID 61165448) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (2S)-2-amino-N-cyclopropyl-4-methyl-N-[(4-methylphenyl)methyl]pentanamide.
| Compound Name | (2S)-2-amino-N-cyclopropyl-4-methyl-N-[(4-methylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 61165448 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2S)-2-amino-N-cyclopropyl-4-methyl-N-[(4-methylphenyl)methyl]pentanamide |
| SMILES | Cc1ccc(CN(C(=O)[C@@H](N)CC(C)C)C2CC2)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-12(2)10-16(18)17(20)19(15-8-9-15)11-14-6-4-13(3)5-7-14/h4-7,12,15-16H,8-11,18H2,1-3H3/t16-/m0/s1 |
| InChIKey | RZIDTSTVYOHFOT-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |