C17H23N3O — CID 61165664
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanone (PubChem CID 61165664) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanone |
|---|---|
| PubChem CID | 61165664 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]methanone |
| SMILES | O=C([C@H]1Cc2ccccc2CN1)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C17H23N3O/c21-17(20-9-8-19-7-3-6-15(19)12-20)16-10-13-4-1-2-5-14(13)11-18-16/h1-2,4-5,15-16,18H,3,6-12H2/t15?,16-/m1/s1 |
| InChIKey | NJDOHHKRBRQDHJ-OEMAIJDKSA-N |
| XLogP | 1.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |