C16H26N2O3 — CID 61166177
(2S)-2-amino-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylpentanamide (PubChem CID 61166177) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 61166177 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2S)-2-amino-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)NC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-6-10(2)15(17)16(19)18-11(3)12-7-8-13(20-4)14(9-12)21-5/h7-11,15H,6,17H2,1-5H3,(H,18,19)/t10?,11?,15-/m0/s1 |
| InChIKey | WATNMFWNPGVNCL-NWHVRFAMSA-N |
| XLogP | 2.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |