C13H14N6O2 — CID 61166939
1-ethyl-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]pyrrolidine-2,5-dione (PubChem CID 61166939) has the molecular formula C13H14N6O2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]pyrrolidine-2,5-dione.
| Compound Name | 1-ethyl-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61166939 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-ethyl-3-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]amino]pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)CC(Nc2cccnc2-n2cncn2)C1=O |
| InChI | InChI=1S/C13H14N6O2/c1-2-18-11(20)6-10(13(18)21)17-9-4-3-5-15-12(9)19-8-14-7-16-19/h3-5,7-8,10,17H,2,6H2,1H3 |
| InChIKey | KBOOJZSEFMLLSF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|