About N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide
N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide (PubChem CID 61167659) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide |
| PubChem CID | 61167659 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide |
| SMILES | CC(C)(C)CNC(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C9H17N3O2S/c1-9(2,3)5-12-8(14)7(13)11-4-6(10)15/h4-5H2,1-3H3,(H2,10,15)(H,11,13)(H,12,14) |
| InChIKey | OMGXGFZWUHJLFD-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide?
The IUPAC name of N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide (CID 61167659) is N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide.
What is the SMILES notation for N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide?
The canonical SMILES for N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide is CC(C)(C)CNC(=O)C(=O)NCC(N)=S.
What is the InChIKey of N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide?
The InChIKey is OMGXGFZWUHJLFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S/c1-9(2,3)5-12-8(14)7(13)11-4-6(10)15/h4-5H2,1-3H3,(H2,10,15)(H,11,13)(H,12,14).
What are the key properties of N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide?
N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide has a molecular weight of 231.32 g/mol, XLogP of -0.45, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-sulfanylideneethyl)-N'-(2,2-dimethylpropyl)oxamide is sourced from PubChem (CID 61167659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).