About 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine
8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 61167703) has the molecular formula C15H20N6
and a molecular weight of 284.37 g/mol. Its IUPAC name is 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine.
Molecular Properties
| Compound Name | 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine |
| PubChem CID | 61167703 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CN1C2CCC1CC(Nc1cccnc1-n1cncn1)C2 |
| InChI | InChI=1S/C15H20N6/c1-20-12-4-5-13(20)8-11(7-12)19-14-3-2-6-17-15(14)21-10-16-9-18-21/h2-3,6,9-13,19H,4-5,7-8H2,1H3 |
| InChIKey | SQXWUFJNBRKEIQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine?
The IUPAC name of 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine (CID 61167703) is 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine.
What is the SMILES notation for 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine?
The canonical SMILES for 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine is CN1C2CCC1CC(Nc1cccnc1-n1cncn1)C2.
What is the InChIKey of 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine?
The InChIKey is SQXWUFJNBRKEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6/c1-20-12-4-5-13(20)8-11(7-12)19-14-3-2-6-17-15(14)21-10-16-9-18-21/h2-3,6,9-13,19H,4-5,7-8H2,1H3.
What are the key properties of 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine?
8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine has a molecular weight of 284.37 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-N-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-8-azabicyclo[3.2.1]octan-3-amine is sourced from PubChem (CID 61167703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).