C13H19NO5S — CID 61168021
3-(2,2-dimethylpropylsulfamoyl)-4-methoxybenzoic acid (PubChem CID 61168021) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylsulfamoyl)-4-methoxybenzoic acid.
| Compound Name | 3-(2,2-dimethylpropylsulfamoyl)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 61168021 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(2,2-dimethylpropylsulfamoyl)-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)NCC(C)(C)C |
| InChI | InChI=1S/C13H19NO5S/c1-13(2,3)8-14-20(17,18)11-7-9(12(15)16)5-6-10(11)19-4/h5-7,14H,8H2,1-4H3,(H,15,16) |
| InChIKey | YCNBVRCXPHSIFX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |