C13H19ClN2O — CID 61168620
N-(3-chlorophenyl)-2-(2,2-dimethylpropylamino)acetamide (PubChem CID 61168620) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(2,2-dimethylpropylamino)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(2,2-dimethylpropylamino)acetamide |
|---|---|
| PubChem CID | 61168620 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-(2,2-dimethylpropylamino)acetamide |
| SMILES | CC(C)(C)CNCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O/c1-13(2,3)9-15-8-12(17)16-11-6-4-5-10(14)7-11/h4-7,15H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | KWBAHVMMWHWQPY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |