C13H26N2O2S — CID 61169174
(2S)-2-amino-4-methylsulfanyl-1-(3-propoxypiperidin-1-yl)butan-1-one (PubChem CID 61169174) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-1-(3-propoxypiperidin-1-yl)butan-1-one.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-1-(3-propoxypiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 61169174 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-1-(3-propoxypiperidin-1-yl)butan-1-one |
| SMILES | CCCOC1CCCN(C(=O)[C@@H](N)CCSC)C1 |
| InChI | InChI=1S/C13H26N2O2S/c1-3-8-17-11-5-4-7-15(10-11)13(16)12(14)6-9-18-2/h11-12H,3-10,14H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | LDUXWYFXXSPPFX-KIYNQFGBSA-N |
| XLogP | 1.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |