About 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine
1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine (PubChem CID 61170822) has the molecular formula C10H14N4OS
and a molecular weight of 238.32 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine |
| PubChem CID | 61170822 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine |
| SMILES | COCCn1cc(NCc2cscn2)cn1 |
| InChI | InChI=1S/C10H14N4OS/c1-15-3-2-14-6-9(5-13-14)11-4-10-7-16-8-12-10/h5-8,11H,2-4H2,1H3 |
| InChIKey | PDFQTFWKBODDGG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine?
The IUPAC name of 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine (CID 61170822) is 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine.
What is the SMILES notation for 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine?
The canonical SMILES for 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine is COCCn1cc(NCc2cscn2)cn1.
What is the InChIKey of 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine?
The InChIKey is PDFQTFWKBODDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4OS/c1-15-3-2-14-6-9(5-13-14)11-4-10-7-16-8-12-10/h5-8,11H,2-4H2,1H3.
What are the key properties of 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine?
1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine has a molecular weight of 238.32 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-N-(1,3-thiazol-4-ylmethyl)pyrazol-4-amine is sourced from PubChem (CID 61170822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).