3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid

C8H12F3NO4 — CID 61171567

IUPAC3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid
SMILESCC(C)C(NC(=O)OCC(F)(F)F)C(=O)O
InChIInChI=1S/C8H12F3NO4/c1-4(2)5(6(13)14)12-7(15)16-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14)
InChIKeyOUNNJHRACCIFBN-UHFFFAOYSA-N
MW243.18 g/mol
LogP1.38
Rot. Bonds4

About 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid

3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid (PubChem CID 61171567) has the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. Its IUPAC name is 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid.

Molecular Properties

Compound Name3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid
PubChem CID61171567
Molecular FormulaC8H12F3NO4
Molecular Weight243.18 g/mol
Exact Mass243.07
IUPAC Name3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid
SMILESCC(C)C(NC(=O)OCC(F)(F)F)C(=O)O
InChIInChI=1S/C8H12F3NO4/c1-4(2)5(6(13)14)12-7(15)16-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14)
InChIKeyOUNNJHRACCIFBN-UHFFFAOYSA-N
XLogP1.38
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.18
LogP ≤ 51.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
The IUPAC name of 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid (CID 61171567) is 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid.
What is the SMILES notation for 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
The canonical SMILES for 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid is CC(C)C(NC(=O)OCC(F)(F)F)C(=O)O.
What is the InChIKey of 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
The InChIKey is OUNNJHRACCIFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO4/c1-4(2)5(6(13)14)12-7(15)16-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14).
What are the key properties of 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid has a molecular weight of 243.18 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid is sourced from PubChem (CID 61171567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).