About (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid
(2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid (PubChem CID 61171768) has the molecular formula C8H12F3NO4
and a molecular weight of 243.18 g/mol. Its IUPAC name is (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid.
Molecular Properties
| Compound Name | (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid |
| PubChem CID | 61171768 |
| Molecular Formula | C8H12F3NO4 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H12F3NO4/c1-4(2)5(6(13)14)12-7(15)16-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14)/t5-/m0/s1 |
| InChIKey | OUNNJHRACCIFBN-YFKPBYRVSA-N |
| XLogP | 1.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
The IUPAC name of (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid (CID 61171768) is (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid.
What is the SMILES notation for (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
The canonical SMILES for (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid is CC(C)[C@H](NC(=O)OCC(F)(F)F)C(=O)O.
What is the InChIKey of (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
The InChIKey is OUNNJHRACCIFBN-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H12F3NO4/c1-4(2)5(6(13)14)12-7(15)16-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14)/t5-/m0/s1.
What are the key properties of (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid?
(2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid has a molecular weight of 243.18 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methyl-2-(2,2,2-trifluoroethoxycarbonylamino)butanoic acid is sourced from PubChem (CID 61171768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).