C15H23FN2O — CID 61172862
(2S)-2-amino-N-[1-(2-fluorophenyl)ethyl]-N,3-dimethylpentanamide (PubChem CID 61172862) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(2-fluorophenyl)ethyl]-N,3-dimethylpentanamide.
| Compound Name | (2S)-2-amino-N-[1-(2-fluorophenyl)ethyl]-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 61172862 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (2S)-2-amino-N-[1-(2-fluorophenyl)ethyl]-N,3-dimethylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)N(C)C(C)c1ccccc1F |
| InChI | InChI=1S/C15H23FN2O/c1-5-10(2)14(17)15(19)18(4)11(3)12-8-6-7-9-13(12)16/h6-11,14H,5,17H2,1-4H3/t10?,11?,14-/m0/s1 |
| InChIKey | ANTDMUDIOWPNQW-MGULZYLOSA-N |
| XLogP | 2.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |