C16H26FN3O — CID 61173891
(2S)-2-amino-N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-methylpentanamide (PubChem CID 61173891) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 61173891 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (2S)-2-amino-N-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1ccc(N(C)C(C)C)c(F)c1 |
| InChI | InChI=1S/C16H26FN3O/c1-6-11(4)15(18)16(21)19-12-7-8-14(13(17)9-12)20(5)10(2)3/h7-11,15H,6,18H2,1-5H3,(H,19,21)/t11?,15-/m0/s1 |
| InChIKey | KSLWNRLBRKHRTF-MHTVFEQDSA-N |
| XLogP | 2.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |