C13H25N3O2 — CID 61173936
1-[(2S)-2-amino-3-methylpentanoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 61173936) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-[(2S)-2-amino-3-methylpentanoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-[(2S)-2-amino-3-methylpentanoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 61173936 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1-[(2S)-2-amino-3-methylpentanoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CCC(C)[C@H](N)C(=O)N1CC(C(N)=O)CCC1C |
| InChI | InChI=1S/C13H25N3O2/c1-4-8(2)11(14)13(18)16-7-10(12(15)17)6-5-9(16)3/h8-11H,4-7,14H2,1-3H3,(H2,15,17)/t8?,9?,10?,11-/m0/s1 |
| InChIKey | RSNGHOPSEZQSNM-QUBJWBRDSA-N |
| XLogP | 0.47 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |