C19H17N3O2 — CID 611750
4,8-diphenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 611750) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4,8-diphenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4,8-diphenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 611750 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4,8-diphenyl-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1CC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C19H17N3O2/c23-18-20(14-9-5-2-6-10-14)19(24)22-17-12-15(21(18)22)11-16(17)13-7-3-1-4-8-13/h1-10,15-17H,11-12H2 |
| InChIKey | SBNUXGWWBGGFKL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |