About [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine
[2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine (PubChem CID 61175170) has the molecular formula C14H15ClN2O
and a molecular weight of 262.74 g/mol. Its IUPAC name is [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine |
| PubChem CID | 61175170 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine |
| SMILES | Cc1cc(C)c(CN)c(Oc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H15ClN2O/c1-9-6-10(2)17-14(13(9)8-16)18-12-5-3-4-11(15)7-12/h3-7H,8,16H2,1-2H3 |
| InChIKey | QYNDIQKBUIRGBF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine?
The IUPAC name of [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine (CID 61175170) is [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine.
What is the SMILES notation for [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine?
The canonical SMILES for [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine is Cc1cc(C)c(CN)c(Oc2cccc(Cl)c2)n1.
What is the InChIKey of [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine?
The InChIKey is QYNDIQKBUIRGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O/c1-9-6-10(2)17-14(13(9)8-16)18-12-5-3-4-11(15)7-12/h3-7H,8,16H2,1-2H3.
What are the key properties of [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine?
[2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine has a molecular weight of 262.74 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chlorophenoxy)-4,6-dimethyl-3-pyridinyl]methanamine is sourced from PubChem (CID 61175170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).