About 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine
1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine (PubChem CID 61175252) has the molecular formula C9H7N5S
and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine |
| PubChem CID | 61175252 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine |
| SMILES | Nc1cnn(-c2ncnc3ccsc23)c1 |
| InChI | InChI=1S/C9H7N5S/c10-6-3-13-14(4-6)9-8-7(1-2-15-8)11-5-12-9/h1-5H,10H2 |
| InChIKey | NNWGIXLHNOKAOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine?
The IUPAC name of 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine (CID 61175252) is 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine.
What is the SMILES notation for 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine?
The canonical SMILES for 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine is Nc1cnn(-c2ncnc3ccsc23)c1.
What is the InChIKey of 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine?
The InChIKey is NNWGIXLHNOKAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5S/c10-6-3-13-14(4-6)9-8-7(1-2-15-8)11-5-12-9/h1-5H,10H2.
What are the key properties of 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine?
1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine has a molecular weight of 217.26 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[3,2-d]pyrimidin-4-ylpyrazol-4-amine is sourced from PubChem (CID 61175252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).