C11H13N5S2 — CID 61175801
4,6-dimethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide (PubChem CID 61175801) has the molecular formula C11H13N5S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4,6-dimethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide.
| Compound Name | 4,6-dimethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 61175801 |
| Molecular Formula | C11H13N5S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4,6-dimethyl-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(C)nc1Sc1nnc(C)s1 |
| InChI | InChI=1S/C11H13N5S2/c1-5-4-6(2)14-10(8(5)9(12)13)18-11-16-15-7(3)17-11/h4H,1-3H3,(H3,12,13) |
| InChIKey | ZQKIOWZPRPZLFS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|